C16H18N4O — CID 61021913
2,3-dimethyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-1H-indole-5-carboxamide (PubChem CID 61021913) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 2,3-dimethyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-1H-indole-5-carboxamide.
| Compound Name | 2,3-dimethyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 61021913 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2,3-dimethyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]ncc1CNC(=O)c1ccc2[nH]c(C)c(C)c2c1 |
| InChI | InChI=1S/C16H18N4O/c1-9-10(2)19-15-5-4-12(6-14(9)15)16(21)17-7-13-8-18-20-11(13)3/h4-6,8,19H,7H2,1-3H3,(H,17,21)(H,18,20) |
| InChIKey | BCQGCLVQLBEEBE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|