C17H23NO3 — CID 6119427
ethyl (E)-3-[(4-tert-butylbenzoyl)amino]but-2-enoate (PubChem CID 6119427) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is ethyl (E)-3-[(4-tert-butylbenzoyl)amino]but-2-enoate.
| Compound Name | ethyl (E)-3-[(4-tert-butylbenzoyl)amino]but-2-enoate |
|---|---|
| PubChem CID | 6119427 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | ethyl (E)-3-[(4-tert-butylbenzoyl)amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H23NO3/c1-6-21-15(19)11-12(2)18-16(20)13-7-9-14(10-8-13)17(3,4)5/h7-11H,6H2,1-5H3,(H,18,20)/b12-11+ |
| InChIKey | ZVSAMIKAQUPMJC-VAWYXSNFSA-N |
| XLogP | 3.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|