C16H21N3O4 — CID 5152071
ethyl 3-[2-[4-(propanoylamino)benzoyl]hydrazinyl]but-2-enoate (PubChem CID 5152071) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is ethyl 3-[2-[4-(propanoylamino)benzoyl]hydrazinyl]but-2-enoate.
| Compound Name | ethyl 3-[2-[4-(propanoylamino)benzoyl]hydrazinyl]but-2-enoate |
|---|---|
| PubChem CID | 5152071 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | ethyl 3-[2-[4-(propanoylamino)benzoyl]hydrazinyl]but-2-enoate |
| SMILES | CCOC(=O)C=C(C)NNC(=O)c1ccc(NC(=O)CC)cc1 |
| InChI | InChI=1S/C16H21N3O4/c1-4-14(20)17-13-8-6-12(7-9-13)16(22)19-18-11(3)10-15(21)23-5-2/h6-10,18H,4-5H2,1-3H3,(H,17,20)(H,19,22) |
| InChIKey | FQESDMJRGSMVRH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|