C20H25N3O6 — CID 7209821
[2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 7209821) has the molecular formula C20H25N3O6 and a molecular weight of 403.44 g/mol. Its IUPAC name is [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 7209821 |
| Molecular Formula | C20H25N3O6 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CC1(C)NC(=O)N(CC(=O)OCC(=O)NC(=O)c2ccc(C(C)(C)C)cc2)C1=O |
| InChI | InChI=1S/C20H25N3O6/c1-19(2,3)13-8-6-12(7-9-13)16(26)21-14(24)11-29-15(25)10-23-17(27)20(4,5)22-18(23)28/h6-9H,10-11H2,1-5H3,(H,22,28)(H,21,24,26) |
| InChIKey | DXIWQZBSAPHLBZ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|