C14H22N4O6 — CID 7209579
[2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 7209579) has the molecular formula C14H22N4O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 7209579 |
| Molecular Formula | C14H22N4O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CC(C)(C)NC(=O)NC(=O)COC(=O)CN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C14H22N4O6/c1-13(2,3)16-11(22)15-8(19)7-24-9(20)6-18-10(21)14(4,5)17-12(18)23/h6-7H2,1-5H3,(H,17,23)(H2,15,16,19,22) |
| InChIKey | LICOXKCFCCMWIM-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|