C16H26N4O6 — CID 2486999
[2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 2486999) has the molecular formula C16H26N4O6 and a molecular weight of 370.41 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 2486999 |
| Molecular Formula | C16H26N4O6 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)OCC(=O)NC(=O)NC(C)(C)C)C1=O |
| InChI | InChI=1S/C16H26N4O6/c1-6-16(7-2)12(23)20(14(25)19-16)8-11(22)26-9-10(21)17-13(24)18-15(3,4)5/h6-9H2,1-5H3,(H,19,25)(H2,17,18,21,24) |
| InChIKey | WTFHRYKQPRRANS-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|