C17H19Cl2N3O5 — CID 2487167
[2-(3,5-dichloroanilino)-2-oxoethyl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 2487167) has the molecular formula C17H19Cl2N3O5 and a molecular weight of 416.26 g/mol. Its IUPAC name is [2-(3,5-dichloroanilino)-2-oxoethyl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [2-(3,5-dichloroanilino)-2-oxoethyl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 2487167 |
| Molecular Formula | C17H19Cl2N3O5 |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | [2-(3,5-dichloroanilino)-2-oxoethyl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)OCC(=O)Nc2cc(Cl)cc(Cl)c2)C1=O |
| InChI | InChI=1S/C17H19Cl2N3O5/c1-3-17(4-2)15(25)22(16(26)21-17)8-14(24)27-9-13(23)20-12-6-10(18)5-11(19)7-12/h5-7H,3-4,8-9H2,1-2H3,(H,20,23)(H,21,26) |
| InChIKey | LJQQJZVJSHIIEM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|