C20H25N3O7 — CID 7691145
methyl 3-[[2-[2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetyl]oxyacetyl]amino]-4-methylbenzoate (PubChem CID 7691145) has the molecular formula C20H25N3O7 and a molecular weight of 419.43 g/mol. Its IUPAC name is methyl 3-[[2-[2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetyl]oxyacetyl]amino]-4-methylbenzoate.
| Compound Name | methyl 3-[[2-[2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetyl]oxyacetyl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 7691145 |
| Molecular Formula | C20H25N3O7 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | methyl 3-[[2-[2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetyl]oxyacetyl]amino]-4-methylbenzoate |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)OCC(=O)Nc2cc(C(=O)OC)ccc2C)C1=O |
| InChI | InChI=1S/C20H25N3O7/c1-5-20(6-2)18(27)23(19(28)22-20)10-16(25)30-11-15(24)21-14-9-13(17(26)29-4)8-7-12(14)3/h7-9H,5-6,10-11H2,1-4H3,(H,21,24)(H,22,28) |
| InChIKey | AFIDPQUSYVXFBM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|