C16H12IN5O3 — CID 30563396
[2-(3-iodoanilino)-2-oxoethyl] 2-(tetrazol-1-yl)benzoate (PubChem CID 30563396) has the molecular formula C16H12IN5O3 and a molecular weight of 449.21 g/mol. Its IUPAC name is [2-(3-iodoanilino)-2-oxoethyl] 2-(tetrazol-1-yl)benzoate.
| Compound Name | [2-(3-iodoanilino)-2-oxoethyl] 2-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 30563396 |
| Molecular Formula | C16H12IN5O3 |
| Molecular Weight | 449.21 g/mol |
| Exact Mass | 449.00 |
| IUPAC Name | [2-(3-iodoanilino)-2-oxoethyl] 2-(tetrazol-1-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1-n1cnnn1)Nc1cccc(I)c1 |
| InChI | InChI=1S/C16H12IN5O3/c17-11-4-3-5-12(8-11)19-15(23)9-25-16(24)13-6-1-2-7-14(13)22-10-18-20-21-22/h1-8,10H,9H2,(H,19,23) |
| InChIKey | CTHSIQUHNZMQIO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|