C14H14N6O4 — CID 7399399
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(tetrazol-1-yl)benzoate (PubChem CID 7399399) has the molecular formula C14H14N6O4 and a molecular weight of 330.30 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(tetrazol-1-yl)benzoate.
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 7399399 |
| Molecular Formula | C14H14N6O4 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(tetrazol-1-yl)benzoate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)c1ccccc1-n1cnnn1 |
| InChI | InChI=1S/C14H14N6O4/c1-2-7-15-14(23)17-12(21)8-24-13(22)10-5-3-4-6-11(10)20-9-16-18-19-20/h2-6,9H,1,7-8H2,(H2,15,17,21,23) |
| InChIKey | DRGIVFDNSRFSQZ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|