(2-bromophenyl)methyl 2-(tetrazol-1-yl)benzoate

C15H11BrN4O2 — CID 7399609

IUPAC(2-bromophenyl)methyl 2-(tetrazol-1-yl)benzoate
SMILESO=C(OCc1ccccc1Br)c1ccccc1-n1cnnn1
InChIInChI=1S/C15H11BrN4O2/c16-13-7-3-1-5-11(13)9-22-15(21)12-6-2-4-8-14(12)20-10-17-18-19-20/h1-8,10H,9H2
InChIKeyXDQNLKIIXCCDQC-UHFFFAOYSA-N
MW359.18 g/mol
LogP2.78
Rot. Bonds4

About (2-bromophenyl)methyl 2-(tetrazol-1-yl)benzoate

(2-bromophenyl)methyl 2-(tetrazol-1-yl)benzoate (PubChem CID 7399609) has the molecular formula C15H11BrN4O2 and a molecular weight of 359.18 g/mol. Its IUPAC name is (2-bromophenyl)methyl 2-(tetrazol-1-yl)benzoate.

Molecular Properties

Compound Name(2-bromophenyl)methyl 2-(tetrazol-1-yl)benzoate
PubChem CID7399609
Molecular FormulaC15H11BrN4O2
Molecular Weight359.18 g/mol
Exact Mass358.01
IUPAC Name(2-bromophenyl)methyl 2-(tetrazol-1-yl)benzoate
SMILESO=C(OCc1ccccc1Br)c1ccccc1-n1cnnn1
InChIInChI=1S/C15H11BrN4O2/c16-13-7-3-1-5-11(13)9-22-15(21)12-6-2-4-8-14(12)20-10-17-18-19-20/h1-8,10H,9H2
InChIKeyXDQNLKIIXCCDQC-UHFFFAOYSA-N
XLogP2.78
TPSA69.90 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500359.18
LogP ≤ 52.78
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze (2-bromophenyl)methyl 2-(tetrazol-1-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-bromophenyl)methyl 2-(tetrazol-1-yl)benzoate?
The IUPAC name of (2-bromophenyl)methyl 2-(tetrazol-1-yl)benzoate (CID 7399609) is (2-bromophenyl)methyl 2-(tetrazol-1-yl)benzoate.
What is the SMILES notation for (2-bromophenyl)methyl 2-(tetrazol-1-yl)benzoate?
The canonical SMILES for (2-bromophenyl)methyl 2-(tetrazol-1-yl)benzoate is O=C(OCc1ccccc1Br)c1ccccc1-n1cnnn1.
What is the InChIKey of (2-bromophenyl)methyl 2-(tetrazol-1-yl)benzoate?
The InChIKey is XDQNLKIIXCCDQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11BrN4O2/c16-13-7-3-1-5-11(13)9-22-15(21)12-6-2-4-8-14(12)20-10-17-18-19-20/h1-8,10H,9H2.
What are the key properties of (2-bromophenyl)methyl 2-(tetrazol-1-yl)benzoate?
(2-bromophenyl)methyl 2-(tetrazol-1-yl)benzoate has a molecular weight of 359.18 g/mol, XLogP of 2.78, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromophenyl)methyl 2-(tetrazol-1-yl)benzoate is sourced from PubChem (CID 7399609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).