C17H18N2O6 — CID 9454789
[2-[[(1R)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl] 5-nitrofuran-2-carboxylate (PubChem CID 9454789) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is [2-[[(1R)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [2-[[(1R)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 9454789 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | [2-[[(1R)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl] 5-nitrofuran-2-carboxylate |
| SMILES | CCc1ccc([C@@H](C)NC(=O)COC(=O)c2ccc([N+](=O)[O-])o2)cc1 |
| InChI | InChI=1S/C17H18N2O6/c1-3-12-4-6-13(7-5-12)11(2)18-15(20)10-24-17(21)14-8-9-16(25-14)19(22)23/h4-9,11H,3,10H2,1-2H3,(H,18,20)/t11-/m1/s1 |
| InChIKey | YKIGETXIDRUVPW-LLVKDONJSA-N |
| XLogP | 2.78 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|