C19H25N3O3 — CID 78772110
N-(2-cyclohexylpyrazol-3-yl)-3-(2-methoxyphenoxy)propanamide (PubChem CID 78772110) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-(2-cyclohexylpyrazol-3-yl)-3-(2-methoxyphenoxy)propanamide.
| Compound Name | N-(2-cyclohexylpyrazol-3-yl)-3-(2-methoxyphenoxy)propanamide |
|---|---|
| PubChem CID | 78772110 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-(2-cyclohexylpyrazol-3-yl)-3-(2-methoxyphenoxy)propanamide |
| SMILES | COc1ccccc1OCCC(=O)Nc1ccnn1C1CCCCC1 |
| InChI | InChI=1S/C19H25N3O3/c1-24-16-9-5-6-10-17(16)25-14-12-19(23)21-18-11-13-20-22(18)15-7-3-2-4-8-15/h5-6,9-11,13,15H,2-4,7-8,12,14H2,1H3,(H,21,23) |
| InChIKey | HXBUWDIUAARVLX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |