C18H23N3O4 — CID 8781434
N-(2-cyclopentylpyrazol-3-yl)-3,4,5-trimethoxybenzamide (PubChem CID 8781434) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-(2-cyclopentylpyrazol-3-yl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(2-cyclopentylpyrazol-3-yl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 8781434 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-(2-cyclopentylpyrazol-3-yl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccnn2C2CCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C18H23N3O4/c1-23-14-10-12(11-15(24-2)17(14)25-3)18(22)20-16-8-9-19-21(16)13-6-4-5-7-13/h8-11,13H,4-7H2,1-3H3,(H,20,22) |
| InChIKey | FYXPVRVMYXUFDJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |