C24H27N3O4 — CID 55429489
N-(2-cyclopentylpyrazol-3-yl)-3,5-dimethoxy-4-phenylmethoxybenzamide (PubChem CID 55429489) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-(2-cyclopentylpyrazol-3-yl)-3,5-dimethoxy-4-phenylmethoxybenzamide.
| Compound Name | N-(2-cyclopentylpyrazol-3-yl)-3,5-dimethoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 55429489 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-(2-cyclopentylpyrazol-3-yl)-3,5-dimethoxy-4-phenylmethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccnn2C2CCCC2)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C24H27N3O4/c1-29-20-14-18(15-21(30-2)23(20)31-16-17-8-4-3-5-9-17)24(28)26-22-12-13-25-27(22)19-10-6-7-11-19/h3-5,8-9,12-15,19H,6-7,10-11,16H2,1-2H3,(H,26,28) |
| InChIKey | FAVTYABAWCRVLN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |