C25H28N4O4 — CID 55803613
3,5-dimethoxy-4-phenylmethoxy-N-(1-pyrimidin-2-ylpiperidin-3-yl)benzamide (PubChem CID 55803613) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 3,5-dimethoxy-4-phenylmethoxy-N-(1-pyrimidin-2-ylpiperidin-3-yl)benzamide.
| Compound Name | 3,5-dimethoxy-4-phenylmethoxy-N-(1-pyrimidin-2-ylpiperidin-3-yl)benzamide |
|---|---|
| PubChem CID | 55803613 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 3,5-dimethoxy-4-phenylmethoxy-N-(1-pyrimidin-2-ylpiperidin-3-yl)benzamide |
| SMILES | COc1cc(C(=O)NC2CCCN(c3ncccn3)C2)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H28N4O4/c1-31-21-14-19(15-22(32-2)23(21)33-17-18-8-4-3-5-9-18)24(30)28-20-10-6-13-29(16-20)25-26-11-7-12-27-25/h3-5,7-9,11-12,14-15,20H,6,10,13,16-17H2,1-2H3,(H,28,30) |
| InChIKey | MYFOQVLZCJJXAS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |