C24H26N4O3 — CID 55802771
2-(4-phenylmethoxyphenoxy)-N-(1-pyrimidin-2-ylpiperidin-3-yl)acetamide (PubChem CID 55802771) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 2-(4-phenylmethoxyphenoxy)-N-(1-pyrimidin-2-ylpiperidin-3-yl)acetamide.
| Compound Name | 2-(4-phenylmethoxyphenoxy)-N-(1-pyrimidin-2-ylpiperidin-3-yl)acetamide |
|---|---|
| PubChem CID | 55802771 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 2-(4-phenylmethoxyphenoxy)-N-(1-pyrimidin-2-ylpiperidin-3-yl)acetamide |
| SMILES | O=C(COc1ccc(OCc2ccccc2)cc1)NC1CCCN(c2ncccn2)C1 |
| InChI | InChI=1S/C24H26N4O3/c29-23(27-20-8-4-15-28(16-20)24-25-13-5-14-26-24)18-31-22-11-9-21(10-12-22)30-17-19-6-2-1-3-7-19/h1-3,5-7,9-14,20H,4,8,15-18H2,(H,27,29) |
| InChIKey | NUPKISPEONBYKC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |