C17H19ClN4O — CID 42592251
2-(3-chlorophenyl)-N-[(3S)-1-pyrimidin-2-ylpiperidin-3-yl]acetamide (PubChem CID 42592251) has the molecular formula C17H19ClN4O and a molecular weight of 330.82 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-[(3S)-1-pyrimidin-2-ylpiperidin-3-yl]acetamide.
| Compound Name | 2-(3-chlorophenyl)-N-[(3S)-1-pyrimidin-2-ylpiperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 42592251 |
| Molecular Formula | C17H19ClN4O |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2-(3-chlorophenyl)-N-[(3S)-1-pyrimidin-2-ylpiperidin-3-yl]acetamide |
| SMILES | O=C(Cc1cccc(Cl)c1)N[C@H]1CCCN(c2ncccn2)C1 |
| InChI | InChI=1S/C17H19ClN4O/c18-14-5-1-4-13(10-14)11-16(23)21-15-6-2-9-22(12-15)17-19-7-3-8-20-17/h1,3-5,7-8,10,15H,2,6,9,11-12H2,(H,21,23)/t15-/m0/s1 |
| InChIKey | RRWRBFSNJTYOPI-HNNXBMFYSA-N |
| XLogP | 2.46 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |