C18H22ClN5O3 — CID 55809472
1-(5-chloro-2,4-dimethoxyphenyl)-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea (PubChem CID 55809472) has the molecular formula C18H22ClN5O3 and a molecular weight of 391.86 g/mol. Its IUPAC name is 1-(5-chloro-2,4-dimethoxyphenyl)-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea.
| Compound Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea |
|---|---|
| PubChem CID | 55809472 |
| Molecular Formula | C18H22ClN5O3 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea |
| SMILES | COc1cc(OC)c(NC(=O)NC2CCCN(c3ncccn3)C2)cc1Cl |
| InChI | InChI=1S/C18H22ClN5O3/c1-26-15-10-16(27-2)14(9-13(15)19)23-18(25)22-12-5-3-8-24(11-12)17-20-6-4-7-21-17/h4,6-7,9-10,12H,3,5,8,11H2,1-2H3,(H2,22,23,25) |
| InChIKey | JWCFQVCUODVZOG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |