C20H24ClN3O3 — CID 75365018
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-(2-cyclohexylpyrazol-3-yl)prop-2-enamide (PubChem CID 75365018) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-(2-cyclohexylpyrazol-3-yl)prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-(2-cyclohexylpyrazol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 75365018 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-(2-cyclohexylpyrazol-3-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccnn2C2CCCCC2)cc(Cl)c1OC |
| InChI | InChI=1S/C20H24ClN3O3/c1-26-17-13-14(12-16(21)20(17)27-2)8-9-19(25)23-18-10-11-22-24(18)15-6-4-3-5-7-15/h8-13,15H,3-7H2,1-2H3,(H,23,25)/b9-8+ |
| InChIKey | VPADEOOYKFLUJE-CMDGGOBGSA-N |
| XLogP | 4.71 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|