C19H19N5O4 — CID 8785238
[2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 4-oxo-3H-phthalazine-1-carboxylate (PubChem CID 8785238) has the molecular formula C19H19N5O4 and a molecular weight of 381.39 g/mol. Its IUPAC name is [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 4-oxo-3H-phthalazine-1-carboxylate.
| Compound Name | [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 4-oxo-3H-phthalazine-1-carboxylate |
|---|---|
| PubChem CID | 8785238 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 4-oxo-3H-phthalazine-1-carboxylate |
| SMILES | O=C(COC(=O)c1n[nH]c(=O)c2ccccc12)Nc1ccnn1C1CCCC1 |
| InChI | InChI=1S/C19H19N5O4/c25-16(21-15-9-10-20-24(15)12-5-1-2-6-12)11-28-19(27)17-13-7-3-4-8-14(13)18(26)23-22-17/h3-4,7-10,12H,1-2,5-6,11H2,(H,21,25)(H,23,26) |
| InChIKey | LXKOFKLUMUEGAC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |