C19H21N5O2 — CID 166186565
N-[2-(cyclohexylmethyl)pyrazol-3-yl]-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 166186565) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[2-(cyclohexylmethyl)pyrazol-3-yl]-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-[2-(cyclohexylmethyl)pyrazol-3-yl]-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 166186565 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-[2-(cyclohexylmethyl)pyrazol-3-yl]-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | O=C(Nc1ccnn1CC1CCCCC1)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C19H21N5O2/c25-18-15-9-5-4-8-14(15)17(22-23-18)19(26)21-16-10-11-20-24(16)12-13-6-2-1-3-7-13/h4-5,8-11,13H,1-3,6-7,12H2,(H,21,26)(H,23,25) |
| InChIKey | GELKLCLCGKAMHB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |