C15H18N4O2 — CID 71564585
4-oxo-N-(piperidin-3-ylmethyl)-3H-phthalazine-1-carboxamide (PubChem CID 71564585) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 4-oxo-N-(piperidin-3-ylmethyl)-3H-phthalazine-1-carboxamide.
| Compound Name | 4-oxo-N-(piperidin-3-ylmethyl)-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 71564585 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 4-oxo-N-(piperidin-3-ylmethyl)-3H-phthalazine-1-carboxamide |
| SMILES | O=C(NCC1CCCNC1)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C15H18N4O2/c20-14-12-6-2-1-5-11(12)13(18-19-14)15(21)17-9-10-4-3-7-16-8-10/h1-2,5-6,10,16H,3-4,7-9H2,(H,17,21)(H,19,20) |
| InChIKey | JSPSDDKQPXOIDQ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |