C21H24N4O4 — CID 7952749
[2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 4-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 7952749) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 4-(2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 4-(2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 7952749 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 4-(2-oxopyrrolidin-1-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2CCCC2=O)cc1)Nc1ccnn1C1CCCC1 |
| InChI | InChI=1S/C21H24N4O4/c26-19(23-18-11-12-22-25(18)17-4-1-2-5-17)14-29-21(28)15-7-9-16(10-8-15)24-13-3-6-20(24)27/h7-12,17H,1-6,13-14H2,(H,23,26) |
| InChIKey | LNNLYTITEVGJGE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |