C20H27N5O3S — CID 9438130
2-[4-(benzenesulfonyl)piperazin-1-yl]-N-(2-cyclopentylpyrazol-3-yl)acetamide (PubChem CID 9438130) has the molecular formula C20H27N5O3S and a molecular weight of 417.54 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyl)piperazin-1-yl]-N-(2-cyclopentylpyrazol-3-yl)acetamide.
| Compound Name | 2-[4-(benzenesulfonyl)piperazin-1-yl]-N-(2-cyclopentylpyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 9438130 |
| Molecular Formula | C20H27N5O3S |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 2-[4-(benzenesulfonyl)piperazin-1-yl]-N-(2-cyclopentylpyrazol-3-yl)acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2ccccc2)CC1)Nc1ccnn1C1CCCC1 |
| InChI | InChI=1S/C20H27N5O3S/c26-20(22-19-10-11-21-25(19)17-6-4-5-7-17)16-23-12-14-24(15-13-23)29(27,28)18-8-2-1-3-9-18/h1-3,8-11,17H,4-7,12-16H2,(H,22,26) |
| InChIKey | ZZINUSTVWSDPCY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |