C16H18ClN3O2 — CID 35142597
2-(3-chlorophenoxy)-N-(2-cyclopentylpyrazol-3-yl)acetamide (PubChem CID 35142597) has the molecular formula C16H18ClN3O2 and a molecular weight of 319.79 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-(2-cyclopentylpyrazol-3-yl)acetamide.
| Compound Name | 2-(3-chlorophenoxy)-N-(2-cyclopentylpyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 35142597 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-(2-cyclopentylpyrazol-3-yl)acetamide |
| SMILES | O=C(COc1cccc(Cl)c1)Nc1ccnn1C1CCCC1 |
| InChI | InChI=1S/C16H18ClN3O2/c17-12-4-3-7-14(10-12)22-11-16(21)19-15-8-9-18-20(15)13-5-1-2-6-13/h3-4,7-10,13H,1-2,5-6,11H2,(H,19,21) |
| InChIKey | XSFZIPSMWGEHCA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |