C17H20ClN3OS — CID 112763552
2-[(3-chlorophenyl)methylsulfanyl]-N-(2-cyclopentylpyrazol-3-yl)acetamide (PubChem CID 112763552) has the molecular formula C17H20ClN3OS and a molecular weight of 349.89 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylsulfanyl]-N-(2-cyclopentylpyrazol-3-yl)acetamide.
| Compound Name | 2-[(3-chlorophenyl)methylsulfanyl]-N-(2-cyclopentylpyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 112763552 |
| Molecular Formula | C17H20ClN3OS |
| Molecular Weight | 349.89 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 2-[(3-chlorophenyl)methylsulfanyl]-N-(2-cyclopentylpyrazol-3-yl)acetamide |
| SMILES | O=C(CSCc1cccc(Cl)c1)Nc1ccnn1C1CCCC1 |
| InChI | InChI=1S/C17H20ClN3OS/c18-14-5-3-4-13(10-14)11-23-12-17(22)20-16-8-9-19-21(16)15-6-1-2-7-15/h3-5,8-10,15H,1-2,6-7,11-12H2,(H,20,22) |
| InChIKey | AYRBLKNXWCZGAV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.89 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |