C20H17ClN4OS — CID 71941114
N-[2-[(3-chlorophenyl)methyl]pyrazol-3-yl]-2-[(4-cyanophenyl)methylsulfanyl]acetamide (PubChem CID 71941114) has the molecular formula C20H17ClN4OS and a molecular weight of 396.90 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)methyl]pyrazol-3-yl]-2-[(4-cyanophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[2-[(3-chlorophenyl)methyl]pyrazol-3-yl]-2-[(4-cyanophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 71941114 |
| Molecular Formula | C20H17ClN4OS |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | N-[2-[(3-chlorophenyl)methyl]pyrazol-3-yl]-2-[(4-cyanophenyl)methylsulfanyl]acetamide |
| SMILES | N#Cc1ccc(CSCC(=O)Nc2ccnn2Cc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C20H17ClN4OS/c21-18-3-1-2-17(10-18)12-25-19(8-9-23-25)24-20(26)14-27-13-16-6-4-15(11-22)5-7-16/h1-10H,12-14H2,(H,24,26) |
| InChIKey | IQGMNTVEMVLXJW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |