C16H12ClN3O3S — CID 84554806
N-(4-chloro-3-nitrophenyl)-2-[(4-cyanophenyl)methylsulfanyl]acetamide (PubChem CID 84554806) has the molecular formula C16H12ClN3O3S and a molecular weight of 361.81 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-2-[(4-cyanophenyl)methylsulfanyl]acetamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)-2-[(4-cyanophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 84554806 |
| Molecular Formula | C16H12ClN3O3S |
| Molecular Weight | 361.81 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-2-[(4-cyanophenyl)methylsulfanyl]acetamide |
| SMILES | N#Cc1ccc(CSCC(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C16H12ClN3O3S/c17-14-6-5-13(7-15(14)20(22)23)19-16(21)10-24-9-12-3-1-11(8-18)2-4-12/h1-7H,9-10H2,(H,19,21) |
| InChIKey | UTPSZJVKMXTLCH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|