C19H25N5O5 — CID 7821349
[2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate (PubChem CID 7821349) has the molecular formula C19H25N5O5 and a molecular weight of 403.44 g/mol. Its IUPAC name is [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate.
| Compound Name | [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
|---|---|
| PubChem CID | 7821349 |
| Molecular Formula | C19H25N5O5 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
| SMILES | O=C(COC(=O)CN1C(=O)NC2(CCCC2)C1=O)Nc1ccnn1C1CCCC1 |
| InChI | InChI=1S/C19H25N5O5/c25-15(21-14-7-10-20-24(14)13-5-1-2-6-13)12-29-16(26)11-23-17(27)19(22-18(23)28)8-3-4-9-19/h7,10,13H,1-6,8-9,11-12H2,(H,21,25)(H,22,28) |
| InChIKey | WEHYCFXYVUDIQU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|