C25H30N2O4 — CID 18266768
5-(2,3-dihydro-1H-inden-5-yl)-3-[2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]-5-methylimidazolidine-2,4-dione (PubChem CID 18266768) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 5-(2,3-dihydro-1H-inden-5-yl)-3-[2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(2,3-dihydro-1H-inden-5-yl)-3-[2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18266768 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 5-(2,3-dihydro-1H-inden-5-yl)-3-[2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC(C)c1ccccc1OCC(O)CN1C(=O)NC(C)(c2ccc3c(c2)CCC3)C1=O |
| InChI | InChI=1S/C25H30N2O4/c1-16(2)21-9-4-5-10-22(21)31-15-20(28)14-27-23(29)25(3,26-24(27)30)19-12-11-17-7-6-8-18(17)13-19/h4-5,9-13,16,20,28H,6-8,14-15H2,1-3H3,(H,26,30) |
| InChIKey | AVAGAOOFAJAZRF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|