C20H29NO4 — CID 42947875
3,3-diethyl-1-[2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]pyrrolidine-2,5-dione (PubChem CID 42947875) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is 3,3-diethyl-1-[2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]pyrrolidine-2,5-dione.
| Compound Name | 3,3-diethyl-1-[2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 42947875 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 3,3-diethyl-1-[2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]pyrrolidine-2,5-dione |
| SMILES | CCC1(CC)CC(=O)N(CC(O)COc2ccccc2C(C)C)C1=O |
| InChI | InChI=1S/C20H29NO4/c1-5-20(6-2)11-18(23)21(19(20)24)12-15(22)13-25-17-10-8-7-9-16(17)14(3)4/h7-10,14-15,22H,5-6,11-13H2,1-4H3 |
| InChIKey | RXIWPMUBKRCRGZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|