C21H31NO4 — CID 42947874
1-[3-(4-tert-butylphenoxy)-2-hydroxypropyl]-3,3-diethylpyrrolidine-2,5-dione (PubChem CID 42947874) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is 1-[3-(4-tert-butylphenoxy)-2-hydroxypropyl]-3,3-diethylpyrrolidine-2,5-dione.
| Compound Name | 1-[3-(4-tert-butylphenoxy)-2-hydroxypropyl]-3,3-diethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 42947874 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 1-[3-(4-tert-butylphenoxy)-2-hydroxypropyl]-3,3-diethylpyrrolidine-2,5-dione |
| SMILES | CCC1(CC)CC(=O)N(CC(O)COc2ccc(C(C)(C)C)cc2)C1=O |
| InChI | InChI=1S/C21H31NO4/c1-6-21(7-2)12-18(24)22(19(21)25)13-16(23)14-26-17-10-8-15(9-11-17)20(3,4)5/h8-11,16,23H,6-7,12-14H2,1-5H3 |
| InChIKey | JJMHKNOEMMTISA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|