C26H34N2O4 — CID 18273144
3-[3-(2-tert-butylphenoxy)-2-hydroxypropyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione (PubChem CID 18273144) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is 3-[3-(2-tert-butylphenoxy)-2-hydroxypropyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[3-(2-tert-butylphenoxy)-2-hydroxypropyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18273144 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 3-[3-(2-tert-butylphenoxy)-2-hydroxypropyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione |
| SMILES | CC(C)c1ccc(C2(C)NC(=O)N(CC(O)COc3ccccc3C(C)(C)C)C2=O)cc1 |
| InChI | InChI=1S/C26H34N2O4/c1-17(2)18-11-13-19(14-12-18)26(6)23(30)28(24(31)27-26)15-20(29)16-32-22-10-8-7-9-21(22)25(3,4)5/h7-14,17,20,29H,15-16H2,1-6H3,(H,27,31) |
| InChIKey | KLJGMUBJYDCKQC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|