C14H19NO2 — CID 82129078
1-[2-(2,5-dimethylphenoxy)ethyl]pyrrolidin-2-one (PubChem CID 82129078) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-[2-(2,5-dimethylphenoxy)ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-(2,5-dimethylphenoxy)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 82129078 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 1-[2-(2,5-dimethylphenoxy)ethyl]pyrrolidin-2-one |
| SMILES | Cc1ccc(C)c(OCCN2CCCC2=O)c1 |
| InChI | InChI=1S/C14H19NO2/c1-11-5-6-12(2)13(10-11)17-9-8-15-7-3-4-14(15)16/h5-6,10H,3-4,7-9H2,1-2H3 |
| InChIKey | SUTLJQKOWORGKK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |