C26H27N3O2 — CID 9193036
(5S)-3-[[benzyl(methyl)amino]methyl]-5-(3,4-dimethylphenyl)-5-phenylimidazolidine-2,4-dione (PubChem CID 9193036) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is (5S)-3-[[benzyl(methyl)amino]methyl]-5-(3,4-dimethylphenyl)-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[[benzyl(methyl)amino]methyl]-5-(3,4-dimethylphenyl)-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9193036 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (5S)-3-[[benzyl(methyl)amino]methyl]-5-(3,4-dimethylphenyl)-5-phenylimidazolidine-2,4-dione |
| SMILES | Cc1ccc([C@]2(c3ccccc3)NC(=O)N(CN(C)Cc3ccccc3)C2=O)cc1C |
| InChI | InChI=1S/C26H27N3O2/c1-19-14-15-23(16-20(19)2)26(22-12-8-5-9-13-22)24(30)29(25(31)27-26)18-28(3)17-21-10-6-4-7-11-21/h4-16H,17-18H2,1-3H3,(H,27,31)/t26-/m0/s1 |
| InChIKey | IUVPAMCBLDUBPN-SANMLTNESA-N |
| XLogP | 4.19 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|