C25H24FN3O3 — CID 31920090
3-[[(3-fluoro-4-methoxyphenyl)methyl-methylamino]methyl]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 31920090) has the molecular formula C25H24FN3O3 and a molecular weight of 433.48 g/mol. Its IUPAC name is 3-[[(3-fluoro-4-methoxyphenyl)methyl-methylamino]methyl]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-[[(3-fluoro-4-methoxyphenyl)methyl-methylamino]methyl]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 31920090 |
| Molecular Formula | C25H24FN3O3 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 3-[[(3-fluoro-4-methoxyphenyl)methyl-methylamino]methyl]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | COc1ccc(CN(C)CN2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)cc1F |
| InChI | InChI=1S/C25H24FN3O3/c1-28(16-18-13-14-22(32-2)21(26)15-18)17-29-23(30)25(27-24(29)31,19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-15H,16-17H2,1-2H3,(H,27,31) |
| InChIKey | HOXCPWLFDHZMDE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|