C27H28FN3O5 — CID 31920225
3-[[(3-fluoro-4-methoxyphenyl)methyl-methylamino]methyl]-5,5-bis(4-methoxyphenyl)imidazolidine-2,4-dione (PubChem CID 31920225) has the molecular formula C27H28FN3O5 and a molecular weight of 493.54 g/mol. Its IUPAC name is 3-[[(3-fluoro-4-methoxyphenyl)methyl-methylamino]methyl]-5,5-bis(4-methoxyphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[[(3-fluoro-4-methoxyphenyl)methyl-methylamino]methyl]-5,5-bis(4-methoxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 31920225 |
| Molecular Formula | C27H28FN3O5 |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 3-[[(3-fluoro-4-methoxyphenyl)methyl-methylamino]methyl]-5,5-bis(4-methoxyphenyl)imidazolidine-2,4-dione |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)NC(=O)N(CN(C)Cc3ccc(OC)c(F)c3)C2=O)cc1 |
| InChI | InChI=1S/C27H28FN3O5/c1-30(16-18-5-14-24(36-4)23(28)15-18)17-31-25(32)27(29-26(31)33,19-6-10-21(34-2)11-7-19)20-8-12-22(35-3)13-9-20/h5-15H,16-17H2,1-4H3,(H,29,33) |
| InChIKey | JCDNKUHBBJNFQO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|