C27H30N4O2S — CID 30628981
(5R)-5-(3,4-dimethylphenyl)-5-phenyl-3-[[4-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]imidazolidine-2,4-dione (PubChem CID 30628981) has the molecular formula C27H30N4O2S and a molecular weight of 474.63 g/mol. Its IUPAC name is (5R)-5-(3,4-dimethylphenyl)-5-phenyl-3-[[4-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(3,4-dimethylphenyl)-5-phenyl-3-[[4-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 30628981 |
| Molecular Formula | C27H30N4O2S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | (5R)-5-(3,4-dimethylphenyl)-5-phenyl-3-[[4-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc([C@@]2(c3ccccc3)NC(=O)N(CN3CCN(Cc4cccs4)CC3)C2=O)cc1C |
| InChI | InChI=1S/C27H30N4O2S/c1-20-10-11-23(17-21(20)2)27(22-7-4-3-5-8-22)25(32)31(26(33)28-27)19-30-14-12-29(13-15-30)18-24-9-6-16-34-24/h3-11,16-17H,12-15,18-19H2,1-2H3,(H,28,33)/t27-/m1/s1 |
| InChIKey | CHHPESZNEZLRLX-HHHXNRCGSA-N |
| XLogP | 3.94 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|