C22H21N5O3S2 — CID 166179099
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide (PubChem CID 166179099) has the molecular formula C22H21N5O3S2 and a molecular weight of 467.58 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 166179099 |
| Molecular Formula | C22H21N5O3S2 |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
| SMILES | CCC1(c2ccccc2)NC(=O)N(CC(=O)Nc2nnc(SCc3ccccc3)s2)C1=O |
| InChI | InChI=1S/C22H21N5O3S2/c1-2-22(16-11-7-4-8-12-16)18(29)27(20(30)24-22)13-17(28)23-19-25-26-21(32-19)31-14-15-9-5-3-6-10-15/h3-12H,2,13-14H2,1H3,(H,24,30)(H,23,25,28) |
| InChIKey | SYTDCHZRRPHWQA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|