C24H22N4O4S — CID 43000456
N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide (PubChem CID 43000456) has the molecular formula C24H22N4O4S and a molecular weight of 462.53 g/mol. Its IUPAC name is N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide.
| Compound Name | N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 43000456 |
| Molecular Formula | C24H22N4O4S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
| SMILES | CCC1(c2ccccc2)NC(=O)N(CC(=O)Nc2nc(-c3ccccc3)c(C(C)=O)s2)C1=O |
| InChI | InChI=1S/C24H22N4O4S/c1-3-24(17-12-8-5-9-13-17)21(31)28(23(32)27-24)14-18(30)25-22-26-19(20(33-22)15(2)29)16-10-6-4-7-11-16/h4-13H,3,14H2,1-2H3,(H,27,32)(H,25,26,30) |
| InChIKey | DLPYOTOEQHXYIJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|