C18H23Cl2N3O3 — CID 8570908
N-butyl-2-[(4S)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-ethylacetamide (PubChem CID 8570908) has the molecular formula C18H23Cl2N3O3 and a molecular weight of 400.31 g/mol. Its IUPAC name is N-butyl-2-[(4S)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-ethylacetamide.
| Compound Name | N-butyl-2-[(4S)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 8570908 |
| Molecular Formula | C18H23Cl2N3O3 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | N-butyl-2-[(4S)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-ethylacetamide |
| SMILES | CCCCN(CC)C(=O)CN1C(=O)N[C@@](C)(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C18H23Cl2N3O3/c1-4-6-9-22(5-2)15(24)11-23-16(25)18(3,21-17(23)26)13-8-7-12(19)10-14(13)20/h7-8,10H,4-6,9,11H2,1-3H3,(H,21,26)/t18-/m0/s1 |
| InChIKey | IZQSCCFXIQVFBK-SFHVURJKSA-N |
| XLogP | 3.41 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|