C18H21Cl2N3O3 — CID 18097560
2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-ethyl-N-(2-methylprop-2-enyl)acetamide (PubChem CID 18097560) has the molecular formula C18H21Cl2N3O3 and a molecular weight of 398.29 g/mol. Its IUPAC name is 2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-ethyl-N-(2-methylprop-2-enyl)acetamide.
| Compound Name | 2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-ethyl-N-(2-methylprop-2-enyl)acetamide |
|---|---|
| PubChem CID | 18097560 |
| Molecular Formula | C18H21Cl2N3O3 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-ethyl-N-(2-methylprop-2-enyl)acetamide |
| SMILES | C=C(C)CN(CC)C(=O)CN1C(=O)NC(C)(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C18H21Cl2N3O3/c1-5-22(9-11(2)3)15(24)10-23-16(25)18(4,21-17(23)26)13-7-6-12(19)8-14(13)20/h6-8H,2,5,9-10H2,1,3-4H3,(H,21,26) |
| InChIKey | URYJEILTDUJGLH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|