C19H17F3N4O4 — CID 92786478
2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]-N-(2,2,2-trifluoroethylcarbamoyl)acetamide (PubChem CID 92786478) has the molecular formula C19H17F3N4O4 and a molecular weight of 422.36 g/mol. Its IUPAC name is 2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]-N-(2,2,2-trifluoroethylcarbamoyl)acetamide.
| Compound Name | 2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]-N-(2,2,2-trifluoroethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 92786478 |
| Molecular Formula | C19H17F3N4O4 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]-N-(2,2,2-trifluoroethylcarbamoyl)acetamide |
| SMILES | C[C@]1(c2ccc3ccccc3c2)NC(=O)N(CC(=O)NC(=O)NCC(F)(F)F)C1=O |
| InChI | InChI=1S/C19H17F3N4O4/c1-18(13-7-6-11-4-2-3-5-12(11)8-13)15(28)26(17(30)25-18)9-14(27)24-16(29)23-10-19(20,21)22/h2-8H,9-10H2,1H3,(H,25,30)(H2,23,24,27,29)/t18-/m1/s1 |
| InChIKey | NEUCNUHSTOMYRT-GOSISDBHSA-N |
| XLogP | 1.99 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|