C22H24F3N3O3 — CID 24981606
3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]propanamide (PubChem CID 24981606) has the molecular formula C22H24F3N3O3 and a molecular weight of 435.45 g/mol. Its IUPAC name is 3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 24981606 |
| Molecular Formula | C22H24F3N3O3 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(CCN1C(=O)C2CC=CCC2C1=O)Nc1cc(C(F)(F)F)ccc1N1CCCC1 |
| InChI | InChI=1S/C22H24F3N3O3/c23-22(24,25)14-7-8-18(27-10-3-4-11-27)17(13-14)26-19(29)9-12-28-20(30)15-5-1-2-6-16(15)21(28)31/h1-2,7-8,13,15-16H,3-6,9-12H2,(H,26,29) |
| InChIKey | LSLSSNRTTHBCGM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|