C19H16F6N4O3S — CID 55364600
1-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone (PubChem CID 55364600) has the molecular formula C19H16F6N4O3S and a molecular weight of 494.42 g/mol. Its IUPAC name is 1-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone.
| Compound Name | 1-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 55364600 |
| Molecular Formula | C19H16F6N4O3S |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 1-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone |
| SMILES | O=C(CSc1ccc(C(F)(F)F)cn1)N1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H16F6N4O3S/c20-18(21,22)12-1-3-14(15(9-12)29(31)32)27-5-7-28(8-6-27)17(30)11-33-16-4-2-13(10-26-16)19(23,24)25/h1-4,9-10H,5-8,11H2 |
| InChIKey | IXIRGXAGMHRATK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|