C14H22N4O5S — CID 118760768
N-[2-methoxy-5-[2-(methylsulfamoyl)ethylcarbamoylamino]phenyl]propanamide (PubChem CID 118760768) has the molecular formula C14H22N4O5S and a molecular weight of 358.42 g/mol. Its IUPAC name is N-[2-methoxy-5-[2-(methylsulfamoyl)ethylcarbamoylamino]phenyl]propanamide.
| Compound Name | N-[2-methoxy-5-[2-(methylsulfamoyl)ethylcarbamoylamino]phenyl]propanamide |
|---|---|
| PubChem CID | 118760768 |
| Molecular Formula | C14H22N4O5S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[2-methoxy-5-[2-(methylsulfamoyl)ethylcarbamoylamino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1cc(NC(=O)NCCS(=O)(=O)NC)ccc1OC |
| InChI | InChI=1S/C14H22N4O5S/c1-4-13(19)18-11-9-10(5-6-12(11)23-3)17-14(20)16-7-8-24(21,22)15-2/h5-6,9,15H,4,7-8H2,1-3H3,(H,18,19)(H2,16,17,20) |
| InChIKey | KWEKYUKPEMZGTG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |