C15H34N2O4 — CID 173415166
6-aminohexylcarbamic acid;ethane-1,2-diol;bis(prop-1-ene) (PubChem CID 173415166) has the molecular formula C15H34N2O4 and a molecular weight of 306.45 g/mol. Its IUPAC name is 6-aminohexylcarbamic acid;ethane-1,2-diol;bis(prop-1-ene).
| Compound Name | 6-aminohexylcarbamic acid;ethane-1,2-diol;bis(prop-1-ene) |
|---|---|
| PubChem CID | 173415166 |
| Molecular Formula | C15H34N2O4 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.25 |
| IUPAC Name | 6-aminohexylcarbamic acid;ethane-1,2-diol;bis(prop-1-ene) |
| SMILES | C=CC.C=CC.NCCCCCCNC(=O)O.OCCO |
| InChI | InChI=1S/C7H16N2O2.2C3H6.C2H6O2/c8-5-3-1-2-4-6-9-7(10)11;2*1-3-2;3-1-2-4/h9H,1-6,8H2,(H,10,11);2*3H,1H2,2H3;3-4H,1-2H2 |
| InChIKey | ZWMMNSQJYQJUFA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|