About butylurea;2-methylaniline
butylurea;2-methylaniline (PubChem CID 175391906) has the molecular formula C12H21N3O
and a molecular weight of 223.32 g/mol. Its IUPAC name is butylurea;2-methylaniline.
Molecular Properties
| Compound Name | butylurea;2-methylaniline |
| PubChem CID | 175391906 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | butylurea;2-methylaniline |
| SMILES | CCCCNC(N)=O.Cc1ccccc1N |
| InChI | InChI=1S/C7H9N.C5H12N2O/c1-6-4-2-3-5-7(6)8;1-2-3-4-7-5(6)8/h2-5H,8H2,1H3;2-4H2,1H3,(H3,6,7,8) |
| InChIKey | PTOIJVMCZGEOJL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze butylurea;2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylurea;2-methylaniline?
The IUPAC name of butylurea;2-methylaniline (CID 175391906) is butylurea;2-methylaniline.
What is the SMILES notation for butylurea;2-methylaniline?
The canonical SMILES for butylurea;2-methylaniline is CCCCNC(N)=O.Cc1ccccc1N.
What is the InChIKey of butylurea;2-methylaniline?
The InChIKey is PTOIJVMCZGEOJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C5H12N2O/c1-6-4-2-3-5-7(6)8;1-2-3-4-7-5(6)8/h2-5H,8H2,1H3;2-4H2,1H3,(H3,6,7,8).
What are the key properties of butylurea;2-methylaniline?
butylurea;2-methylaniline has a molecular weight of 223.32 g/mol, XLogP of 2.03, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butylurea;2-methylaniline is sourced from PubChem (CID 175391906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).