C50H97O7P — CID 166948214
1-[2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]propylidenephosphane (PubChem CID 166948214) has the molecular formula C50H97O7P and a molecular weight of 841.29 g/mol. Its IUPAC name is 1-[2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]propylidenephosphane.
| Compound Name | 1-[2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]propylidenephosphane |
|---|---|
| PubChem CID | 166948214 |
| Molecular Formula | C50H97O7P |
| Molecular Weight | 841.29 g/mol |
| Exact Mass | 840.70 |
| IUPAC Name | 1-[2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]propylidenephosphane |
| SMILES | [H]/P=C(\CC)OCCOCCOCCOCCOCC(COCCCCCCCC/C=C\CCCCCCCC)OCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C50H97O7P/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-54-47-49(48-55-44-43-52-40-39-51-41-42-53-45-46-57-50(58)6-3)56-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h19-22,49,58H,4-18,23-48H2,1-3H3/b21-19-,22-20- |
| InChIKey | SOXBQDJYYRRCEK-WRBBJXAJSA-N |
| XLogP | 14.23 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.29 |
| LogP ≤ 5 | 14.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|